Products 1207754-84-4
CAS 1207754-84-4 appears in our catalog under these names: 2-tert-butyl-1-(4-methylphenyl)sulfonylaziridine, R–2–(1，1–diMethylethyl)–1–((4–Methylphenyl)sulfonyl)–Aziridine. Offered by: Chemat, GLPBio. Available pack sizes: 50mg, 250mg, 1g.
2-tert-butyl-1-(4-methylphenyl)sulfonylaziridine (CAS 1207754-84-4) is a chemical compound with the molecular formula C13H19NO2S and a molecular weight of 253.36 g/mol. IUPAC name: 2-tert-butyl-1-(4-methylphenyl)sulfonylaziridine. InChIKey: NZARMBGWBDHTMI-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2S |
|---|---|
| Molecular weight | 253.36 g/mol |
| IUPAC name | 2-tert-butyl-1-(4-methylphenyl)sulfonylaziridine |
| InChIKey | NZARMBGWBDHTMI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC2C(C)(C)C |
Computed by PubChem (NCBI)