CAS 1208-52-2 appears in our catalog under these names: 2–(4–Aminobenzyl)aniline, 2-(4-Aminobenzyl)aniline, 2-(4-Aminobenzyl)aniline 95%, 2-(4-Aminobenzyl)aniline, 98%, 2-(4-Aminobenzyl)aniline, 50 mg. Offered by: GLPBio, Biosynth, HPC Standards, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 25mg, 5g, 50mg, 500mg, 1000mg.
2-[(4-aminophenyl)methyl]aniline (CAS 1208-52-2) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 198.26 g/mol. IUPAC name: 2-[(4-aminophenyl)methyl]aniline. InChIKey: UTNMPUFESIRPQP-UHFFFAOYSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 2-[(4-aminophenyl)methyl]aniline |
| InChIKey | UTNMPUFESIRPQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=CC=C(C=C2)N)N |
Computed by PubChem (NCBI)