Products 1208-65-7
CAS 1208-65-7 appears in our catalog under these names: 3–(4–(tert–Butyl)phenyl)acrylic acid, 3-(4-tert-Butylbenzene)prop-2-enoic acid, 3-(4-(tert-Butyl)phenyl)acrylic acid, 95% （E）, 95% （E）, 3-(4-tert-butylphenyl)acrylic acid, 98%, 3-(4-(tert-Butyl)phenyl)acrylic acid, 95% （E）. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
(E)-3-(4-tert-butylphenyl)prop-2-enoic acid (CAS 1208-65-7) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: (E)-3-(4-tert-butylphenyl)prop-2-enoic acid. InChIKey: QFSPZKLJQZSLQU-RMKNXTFCSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | (E)-3-(4-tert-butylphenyl)prop-2-enoic acid |
| InChIKey | QFSPZKLJQZSLQU-RMKNXTFCSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(Tert-butyl)cinnamic acid, 3-(4-(tert-Butyl)phenyl)acrylic acid, (E)-3-(4-(tert-butyl)phenyl)acrylic acid, 3-(4-tert-Butylbenzene)prop-2-enoic Acid, (2E)-3-(4-tert-butylphenyl)prop-2-enoic acid, 3-(4-tert-butylphenyl)acrylic acid, 4-tert-butylcinnamic acid, (E)-3-(4-tert-butylphenyl)prop-2-enoic acid, 3-[4-(tert-butyl)phenyl]acrylic acid, p-tert-Butylcinnamic acid