CAS 1208077-19-3 appears in our catalog under these names: 2-Chloro-4-fluoro-5-methylbenzenesulfonamide, 97%, 2-Chloro-4-fluoro-5-methylbenzene sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloro-4-fluoro-5-methylbenzenesulfonamide (CAS 1208077-19-3) is a chemical compound with the molecular formula C7H7ClFNO2S and a molecular weight of 223.65 g/mol. IUPAC name: 2-chloro-4-fluoro-5-methylbenzenesulfonamide. InChIKey: QTZFXXLSYQSELV-UHFFFAOYSA-N.
| Molecular formula | C7H7ClFNO2S |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 2-chloro-4-fluoro-5-methylbenzenesulfonamide |
| InChIKey | QTZFXXLSYQSELV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)