Products 174303-00-5
CAS 174303-00-5 is the registry number for (2-Chloro-6-fluorophenyl)methanesulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2-chloro-6-fluorophenyl)methanesulfonamide (CAS 174303-00-5) is a chemical compound with the molecular formula C7H7ClFNO2S and a molecular weight of 223.65 g/mol. IUPAC name: (2-chloro-6-fluorophenyl)methanesulfonamide. InChIKey: HZXUSJFMOMJRJX-UHFFFAOYSA-N.
| Molecular formula | C7H7ClFNO2S |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | (2-chloro-6-fluorophenyl)methanesulfonamide |
| InChIKey | HZXUSJFMOMJRJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CS(=O)(=O)N)F |
Computed by PubChem (NCBI)