Products 400900-02-9

CAS 400900-02-9 appears in our catalog under these names: N-((4-fluorophenyl)methyl)sulfamoyl chloride, 95%, N-((4-Fluorophenyl)methyl)sulfamoyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.

N-[(4-fluorophenyl)methyl]sulfamoyl chloride (CAS 400900-02-9) is a chemical compound with the molecular formula C7H7ClFNO2S and a molecular weight of 223.65 g/mol. IUPAC name: N-[(4-fluorophenyl)methyl]sulfamoyl chloride. InChIKey: IOLLFQPPMHKVFH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClFNO2S
Molecular weight223.65 g/mol
IUPAC nameN-[(4-fluorophenyl)methyl]sulfamoyl chloride
InChIKeyIOLLFQPPMHKVFH-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CNS(=O)(=O)Cl)F

Computed by PubChem (NCBI)