CAS 400900-02-9 appears in our catalog under these names: N-((4-fluorophenyl)methyl)sulfamoyl chloride, 95%, N-((4-Fluorophenyl)methyl)sulfamoyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
N-[(4-fluorophenyl)methyl]sulfamoyl chloride (CAS 400900-02-9) is a chemical compound with the molecular formula C7H7ClFNO2S and a molecular weight of 223.65 g/mol. IUPAC name: N-[(4-fluorophenyl)methyl]sulfamoyl chloride. InChIKey: IOLLFQPPMHKVFH-UHFFFAOYSA-N.
| Molecular formula | C7H7ClFNO2S |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | N-[(4-fluorophenyl)methyl]sulfamoyl chloride |
| InChIKey | IOLLFQPPMHKVFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNS(=O)(=O)Cl)F |
Computed by PubChem (NCBI)