CAS 1208078-11-8 is the registry number for N-[2-Fluoro-4-(methylsulfonyl)phenyl]piperidin-4-amine hydrochloride, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
N-(2-fluoro-4-methylsulfonylphenyl)piperidin-4-amine;hydrochloride (CAS 1208078-11-8) is a chemical compound with the molecular formula C12H18ClFN2O2S and a molecular weight of 308.80 g/mol. IUPAC name: N-(2-fluoro-4-methylsulfonylphenyl)piperidin-4-amine;hydrochloride. InChIKey: DPOCMQDENCVJGT-UHFFFAOYSA-N.
| Molecular formula | C12H18ClFN2O2S |
|---|---|
| Molecular weight | 308.80 g/mol |
| IUPAC name | N-(2-fluoro-4-methylsulfonylphenyl)piperidin-4-amine;hydrochloride |
| InChIKey | DPOCMQDENCVJGT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)NC2CCNCC2)F.Cl |
Computed by PubChem (NCBI)