Products 1353985-93-9
CAS 1353985-93-9 appears in our catalog under these names: (1-((4-Fluorophenyl)sulfonyl)piperidin-3-yl)methanamine hydrochloride, 95%, 95%, C-[1-(4-Fluoro-benzenesulfonyl)-piperidin-3-yl]-methylamine hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
[1-(4-fluorophenyl)sulfonylpiperidin-3-yl]methanamine;hydrochloride (CAS 1353985-93-9) is a chemical compound with the molecular formula C12H18ClFN2O2S and a molecular weight of 308.80 g/mol. IUPAC name: [1-(4-fluorophenyl)sulfonylpiperidin-3-yl]methanamine;hydrochloride. InChIKey: FPIJKWITVNNBDR-UHFFFAOYSA-N.
| Molecular formula | C12H18ClFN2O2S |
|---|---|
| Molecular weight | 308.80 g/mol |
| IUPAC name | [1-(4-fluorophenyl)sulfonylpiperidin-3-yl]methanamine;hydrochloride |
| InChIKey | FPIJKWITVNNBDR-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)S(=O)(=O)C2=CC=C(C=C2)F)CN.Cl |
Computed by PubChem (NCBI)