Products 1353972-68-5
CAS 1353972-68-5 appears in our catalog under these names: 1-((4-Fluorophenyl)sulfonyl)-N-methylpiperidin-3-amine hydrochloride, 95%, 95%, [1-(4-Fluoro-benzenesulfonyl)-piperidin-3-yl]-methyl-amine hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(4-fluorophenyl)sulfonyl-N-methylpiperidin-3-amine;hydrochloride (CAS 1353972-68-5) is a chemical compound with the molecular formula C12H18ClFN2O2S and a molecular weight of 308.80 g/mol. IUPAC name: 1-(4-fluorophenyl)sulfonyl-N-methylpiperidin-3-amine;hydrochloride. InChIKey: FNLFYBBLYHJTKL-UHFFFAOYSA-N.
| Molecular formula | C12H18ClFN2O2S |
|---|---|
| Molecular weight | 308.80 g/mol |
| IUPAC name | 1-(4-fluorophenyl)sulfonyl-N-methylpiperidin-3-amine;hydrochloride |
| InChIKey | FNLFYBBLYHJTKL-UHFFFAOYSA-N |
| SMILES | CNC1CCCN(C1)S(=O)(=O)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)