CAS 1208078-25-4 is the registry number for 6-Chloro-2,3-difluorobenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-chloro-2,3-difluorobenzoyl chloride (CAS 1208078-25-4) is a chemical compound with the molecular formula C7H2Cl2F2O and a molecular weight of 210.99 g/mol. IUPAC name: 6-chloro-2,3-difluorobenzoyl chloride. InChIKey: CHLDUAMDKJNJKC-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F2O |
|---|---|
| Molecular weight | 210.99 g/mol |
| IUPAC name | 6-chloro-2,3-difluorobenzoyl chloride |
| InChIKey | CHLDUAMDKJNJKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)C(=O)Cl)Cl |
Computed by PubChem (NCBI)