CAS 261762-43-0 is the registry number for 3-Chloro-2,6-difluorobenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-2,6-difluorobenzoyl chloride (CAS 261762-43-0) is a chemical compound with the molecular formula C7H2Cl2F2O and a molecular weight of 210.99 g/mol. IUPAC name: 3-chloro-2,6-difluorobenzoyl chloride. InChIKey: LUTDLSSUGZTZBP-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F2O |
|---|---|
| Molecular weight | 210.99 g/mol |
| IUPAC name | 3-chloro-2,6-difluorobenzoyl chloride |
| InChIKey | LUTDLSSUGZTZBP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)Cl)F)Cl |
Computed by PubChem (NCBI)