CAS 157373-00-7 appears in our catalog under these names: 3-Chloro-2,4-difluorobenzoyl chloride, 95%, 3-Chloro-2,4-difluorobenzoyl chloride, 95+%, 3-Chloro-2,4-difluorobenzoyl chloride. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g.
3-chloro-2,4-difluorobenzoyl chloride (CAS 157373-00-7) is a chemical compound with the molecular formula C7H2Cl2F2O and a molecular weight of 210.99 g/mol. IUPAC name: 3-chloro-2,4-difluorobenzoyl chloride. InChIKey: XGKKQSXUVHMKGM-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F2O |
|---|---|
| Molecular weight | 210.99 g/mol |
| IUPAC name | 3-chloro-2,4-difluorobenzoyl chloride |
| InChIKey | XGKKQSXUVHMKGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)Cl)F)Cl)F |
Computed by PubChem (NCBI)