CAS 1208083-19-5 is the registry number for Ethyl 4'-amino-3'-fluoro-[1,1'-biphenyl]-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-(4-amino-3-fluorophenyl)benzoate (CAS 1208083-19-5) is a chemical compound with the molecular formula C15H14FNO2 and a molecular weight of 259.27 g/mol. IUPAC name: ethyl 4-(4-amino-3-fluorophenyl)benzoate. InChIKey: HPOLNYCFERFOBG-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO2 |
|---|---|
| Molecular weight | 259.27 g/mol |
| IUPAC name | ethyl 4-(4-amino-3-fluorophenyl)benzoate |
| InChIKey | HPOLNYCFERFOBG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=CC(=C(C=C2)N)F |
Computed by PubChem (NCBI)