CAS 159707-18-3 appears in our catalog under these names: (S)-2-(Benzylamino)-2-(4-fluorophenyl)acetic acid, 95%, (S)–2–(benzylamino)–2–(4–fluorophenyl)acetic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(2S)-2-(benzylamino)-2-(4-fluorophenyl)acetic acid (CAS 159707-18-3) is a chemical compound with the molecular formula C15H14FNO2 and a molecular weight of 259.27 g/mol. IUPAC name: (2S)-2-(benzylamino)-2-(4-fluorophenyl)acetic acid. InChIKey: KGMFSTPSQOLFGB-AWEZNQCLSA-N.
| Molecular formula | C15H14FNO2 |
|---|---|
| Molecular weight | 259.27 g/mol |
| IUPAC name | (2S)-2-(benzylamino)-2-(4-fluorophenyl)acetic acid |
| InChIKey | KGMFSTPSQOLFGB-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)CN[C@@H](C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)