Products 1020973-31-2
CAS 1020973-31-2 is the registry number for N-(1-(4-[(4-Fluorophenyl)methoxy]phenyl)ethylidene)hydroxylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(NE)-N-[1-[4-[(4-fluorophenyl)methoxy]phenyl]ethylidene]hydroxylamine (CAS 1020973-31-2) is a chemical compound with the molecular formula C15H14FNO2 and a molecular weight of 259.27 g/mol. IUPAC name: (NE)-N-[1-[4-[(4-fluorophenyl)methoxy]phenyl]ethylidene]hydroxylamine. InChIKey: DVFHLLSPLNIERZ-GZTJUZNOSA-N.
| Molecular formula | C15H14FNO2 |
|---|---|
| Molecular weight | 259.27 g/mol |
| IUPAC name | (NE)-N-[1-[4-[(4-fluorophenyl)methoxy]phenyl]ethylidene]hydroxylamine |
| InChIKey | DVFHLLSPLNIERZ-GZTJUZNOSA-N |
| SMILES | C/C(=N\O)/C1=CC=C(C=C1)OCC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)