CAS 478247-85-7 is the registry number for 1-Cyclopropyl-3-[(4-fluorophenyl)methyl]-4-hydroxy-1,2-dihydropyridin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-cyclopropyl-3-[(4-fluorophenyl)methyl]-4-hydroxypyridin-2-one (CAS 478247-85-7) is a chemical compound with the molecular formula C15H14FNO2 and a molecular weight of 259.27 g/mol. IUPAC name: 1-cyclopropyl-3-[(4-fluorophenyl)methyl]-4-hydroxypyridin-2-one. InChIKey: YOARALDHKFYYHF-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO2 |
|---|---|
| Molecular weight | 259.27 g/mol |
| IUPAC name | 1-cyclopropyl-3-[(4-fluorophenyl)methyl]-4-hydroxypyridin-2-one |
| InChIKey | YOARALDHKFYYHF-UHFFFAOYSA-N |
| SMILES | C1CC1N2C=CC(=C(C2=O)CC3=CC=C(C=C3)F)O |
Computed by PubChem (NCBI)