CAS 1208109-55-0 appears in our catalog under these names: Guaiacol-Beta-D-glucopyranoside-d3, >95% (HPLC), Guaiacol-β-D-glucopyranoside-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-(trideuteriomethoxy)phenoxy]oxane-3,4,5-triol (CAS 1208109-55-0) is a chemical compound with the molecular formula C13H18O7 and a molecular weight of 289.30 g/mol. IUPAC name: (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-(trideuteriomethoxy)phenoxy]oxane-3,4,5-triol. InChIKey: WBZPEZUBVIAKKS-ROFQSTBASA-N.
| Molecular formula | C13H18O7 |
|---|---|
| Molecular weight | 289.30 g/mol |
| IUPAC name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-(trideuteriomethoxy)phenoxy]oxane-3,4,5-triol |
| InChIKey | WBZPEZUBVIAKKS-ROFQSTBASA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC=C1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)