CAS 3150-20-7 appears in our catalog under these names: 4-Methoxyphenyl beta-d-galactopyranoside, 98%, p–Methoxyphenyl b–D–galactoside, 4-Methoxyphenyl beta-D-Galactopyranoside, >98.0%(HPLC), 4-Methoxyphenyl b-D-galactopyranoside, 4-Methoxyphenyl beta-D-Galactopyranoside 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Ambeed. Available pack sizes: 25g, 1g, 5g, 10g, 50g, 100g, 250mg.
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxane-3,4,5-triol (CAS 3150-20-7) is a chemical compound with the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. IUPAC name: (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxane-3,4,5-triol. InChIKey: SIXFVXJMCGPTRB-KSSYENDESA-N.
| Molecular formula | C13H18O7 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxane-3,4,5-triol |
| InChIKey | SIXFVXJMCGPTRB-KSSYENDESA-N |
| SMILES | COC1=CC=C(C=C1)O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)