CAS 198013-55-7 is the registry number for Gastrodin Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(hydroxymethyl)phenoxy]oxane-3,4,5-triol (CAS 198013-55-7) is a chemical compound with the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(hydroxymethyl)phenoxy]oxane-3,4,5-triol. InChIKey: PUQSUZTXKPLAPR-LBELIVKGSA-N.
| Molecular formula | C13H18O7 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(hydroxymethyl)phenoxy]oxane-3,4,5-triol |
| InChIKey | PUQSUZTXKPLAPR-LBELIVKGSA-N |
| SMILES | C1=CC(=CC=C1CO)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)