Products 120824-55-7

CAS 120824-55-7 is the registry number for Fenoprofen Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Propan-2-yl 2-(3-phenoxyphenyl)propanoate (CAS 120824-55-7) is a chemical compound with the molecular formula C18H20O3 and a molecular weight of 284.3 g/mol. IUPAC name: propan-2-yl 2-(3-phenoxyphenyl)propanoate. InChIKey: QHPVDNJUIUHYBF-UHFFFAOYSA-N.

Identity
Molecular formulaC18H20O3
Molecular weight284.3 g/mol
IUPAC namepropan-2-yl 2-(3-phenoxyphenyl)propanoate
InChIKeyQHPVDNJUIUHYBF-UHFFFAOYSA-N
SMILESCC(C)OC(=O)C(C)C1=CC(=CC=C1)OC2=CC=CC=C2

Computed by PubChem (NCBI)