Products 120838-14-4
CAS 120838-14-4 is the registry number for 1α,7α,10αH-Guaian-4,11-dien-3-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5R,8S,8aS)-3,8-dimethyl-5-prop-1-en-2-yl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one (CAS 120838-14-4) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: (5R,8S,8aS)-3,8-dimethyl-5-prop-1-en-2-yl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one. InChIKey: CESATEXQMONATC-UHTWSYAYSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | (5R,8S,8aS)-3,8-dimethyl-5-prop-1-en-2-yl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one |
| InChIKey | CESATEXQMONATC-UHTWSYAYSA-N |
| SMILES | C[C@H]1CC[C@H](CC2=C(C(=O)C[C@@H]12)C)C(=C)C |
Computed by PubChem (NCBI)