CAS 1208712-29-1 appears in our catalog under these names: 2-(3-(Cyclooctylsulfamoyl)phenyl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(3-(Cyclooctylsulfamoyl)phenyl)-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-[3-(cyclooctylsulfamoyl)phenyl]-1,3-thiazole-4-carboxylic acid (CAS 1208712-29-1) is a chemical compound with the molecular formula C18H22N2O4S2 and a molecular weight of 394.5 g/mol. IUPAC name: 2-[3-(cyclooctylsulfamoyl)phenyl]-1,3-thiazole-4-carboxylic acid. InChIKey: DXDVVOQDRGLGNF-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O4S2 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | 2-[3-(cyclooctylsulfamoyl)phenyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | DXDVVOQDRGLGNF-UHFFFAOYSA-N |
| SMILES | C1CCCC(CCC1)NS(=O)(=O)C2=CC=CC(=C2)C3=NC(=CS3)C(=O)O |
Computed by PubChem (NCBI)