CAS 2034155-63-8 is the registry number for 6-Ethoxy-3-ethylbenzo[d]thiazol-2(3H)-imine 4-methylbenzenesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-ethoxy-3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid (CAS 2034155-63-8) is a chemical compound with the molecular formula C18H22N2O4S2 and a molecular weight of 394.5 g/mol. IUPAC name: 6-ethoxy-3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid. InChIKey: ALFASKAJYWAOOX-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O4S2 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | 6-ethoxy-3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid |
| InChIKey | ALFASKAJYWAOOX-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)OCC)SC1=N.CC1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)