CAS 17046-84-3 appears in our catalog under these names: 1,4–Ditosylpiperazine, 1,4-Ditosylpiperazine, 95%+, 95%+, 1,4-Ditosylpiperazine, 95+%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
1,4-bis-(4-methylphenyl)sulfonylpiperazine (CAS 17046-84-3) is a chemical compound with the molecular formula C18H22N2O4S2 and a molecular weight of 394.5 g/mol. IUPAC name: 1,4-bis-(4-methylphenyl)sulfonylpiperazine. InChIKey: LMIXCJFVEQOWSQ-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O4S2 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | 1,4-bis-(4-methylphenyl)sulfonylpiperazine |
| InChIKey | LMIXCJFVEQOWSQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)S(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)