CAS 1208757-40-7 is the registry number for 1-(2-Oxo-2-(pyrrolidin-1-yl)ethyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(2-oxo-2-pyrrolidin-1-ylethyl)triazole-4-carboxylic acid (CAS 1208757-40-7) is a chemical compound with the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. IUPAC name: 1-(2-oxo-2-pyrrolidin-1-ylethyl)triazole-4-carboxylic acid. InChIKey: NGCQILPCQQLXBX-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O3 |
|---|---|
| Molecular weight | 224.22 g/mol |
| IUPAC name | 1-(2-oxo-2-pyrrolidin-1-ylethyl)triazole-4-carboxylic acid |
| InChIKey | NGCQILPCQQLXBX-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)CN2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)