CAS 51168-26-4 appears in our catalog under these names: Methylliberine, Methylliberine 97%, 2-Methoxy-1,7,9-trimethyl-7,9-dihydro-1H-purine-6,8-dione, 98%, 98%, Methylliberine, 99.94%, Methylliberine (Standard). Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 100mg, 10g, 25g, 5g, 50g, 50mg, 5mg.
2-methoxy-1,7,9-trimethylpurine-6,8-dione (CAS 51168-26-4) is a chemical compound with the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. IUPAC name: 2-methoxy-1,7,9-trimethylpurine-6,8-dione. InChIKey: ZVQXCXPGLSBNCX-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O3 |
|---|---|
| Molecular weight | 224.22 g/mol |
| IUPAC name | 2-methoxy-1,7,9-trimethylpurine-6,8-dione |
| InChIKey | ZVQXCXPGLSBNCX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(N=C(N(C2=O)C)OC)N(C1=O)C |
Computed by PubChem (NCBI)