CAS 1329296-85-6 is the registry number for 2-Methyl-N'-(5-nitropyridin-2-yl)propanehydrazide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-methyl-N'-(5-nitro-2-pyridinyl)propanehydrazide (CAS 1329296-85-6) is a chemical compound with the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. IUPAC name: 2-methyl-N'-(5-nitro-2-pyridinyl)propanehydrazide. InChIKey: OJDYCURBFTYNHM-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O3 |
|---|---|
| Molecular weight | 224.22 g/mol |
| IUPAC name | 2-methyl-N'-(5-nitro-2-pyridinyl)propanehydrazide |
| InChIKey | OJDYCURBFTYNHM-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NNC1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)