Products 1208795-98-5
CAS 1208795-98-5 is the registry number for 2-Bromo-7-ethyl-5H-(1,3,4)thiadiazolo(3,2-a)pyrimidin-5-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-bromo-7-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (CAS 1208795-98-5) is a chemical compound with the molecular formula C7H6BrN3OS and a molecular weight of 260.11 g/mol. IUPAC name: 2-bromo-7-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one. InChIKey: YUWKSPYNEOVDQO-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3OS |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | 2-bromo-7-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| InChIKey | YUWKSPYNEOVDQO-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=O)N2C(=N1)SC(=N2)Br |
Computed by PubChem (NCBI)