Products 1696270-67-3
CAS 1696270-67-3 is the registry number for 4-((5-Bromothiophen-2-yl)methyl)-2,4-dihydro-3H-1,2,4-triazol-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(5-bromothiophen-2-yl)methyl]-1H-1,2,4-triazol-5-one (CAS 1696270-67-3) is a chemical compound with the molecular formula C7H6BrN3OS and a molecular weight of 260.11 g/mol. IUPAC name: 4-[(5-bromothiophen-2-yl)methyl]-1H-1,2,4-triazol-5-one. InChIKey: XCRVXGZZYUJXDM-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3OS |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | 4-[(5-bromothiophen-2-yl)methyl]-1H-1,2,4-triazol-5-one |
| InChIKey | XCRVXGZZYUJXDM-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)CN2C=NNC2=O |
Computed by PubChem (NCBI)