Products 1232815-58-5
CAS 1232815-58-5 is the registry number for 5-Bromo-2-(methylsulfinyl)pyrrolo[2,1-f][1,2,4]triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-methylsulfinylpyrrolo[2,1-f][1,2,4]triazine (CAS 1232815-58-5) is a chemical compound with the molecular formula C7H6BrN3OS and a molecular weight of 260.11 g/mol. IUPAC name: 5-bromo-2-methylsulfinylpyrrolo[2,1-f][1,2,4]triazine. InChIKey: YJZPZIBYQKILCL-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3OS |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | 5-bromo-2-methylsulfinylpyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | YJZPZIBYQKILCL-UHFFFAOYSA-N |
| SMILES | CS(=O)C1=NN2C=CC(=C2C=N1)Br |
Computed by PubChem (NCBI)