CAS 120902-45-6 appears in our catalog under these names: 5-Bromo-3,3-dimethyl-2,3-dihydro-1h-indol-2-one, 95%, 5-Bromo-3,3-dimethyl-2,3-dihydro-1H-indol-2-one, 5-Bromo-3,3-dimethylindolin-2-one 98%, 5-Bromo-3,3-dimethylindolin-2-one, 98%, 98%, 5-BROMO-3,3-DIMETHYLINDOLIN-2-ONE, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g, 25g, 100mg, 500mg, 50g.
5-bromo-3,3-dimethyl-1H-indol-2-one (CAS 120902-45-6) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 5-bromo-3,3-dimethyl-1H-indol-2-one. InChIKey: YCHSJOIHTKPUCQ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 5-bromo-3,3-dimethyl-1H-indol-2-one |
| InChIKey | YCHSJOIHTKPUCQ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)Br)NC1=O)C |
Computed by PubChem (NCBI)