Products 120912-37-0

CAS 120912-37-0 is the registry number for 5-Isocyanatoindane, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg, 2.5g.

Structural formula: {0} (CAS {1})

5-isocyanato-2,3-dihydro-1H-indene (CAS 120912-37-0) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 5-isocyanato-2,3-dihydro-1H-indene. InChIKey: PYJJKIOYUUDDDM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO
Molecular weight159.18 g/mol
IUPAC name5-isocyanato-2,3-dihydro-1H-indene
InChIKeyPYJJKIOYUUDDDM-UHFFFAOYSA-N
SMILESC1CC2=C(C1)C=C(C=C2)N=C=O

Computed by PubChem (NCBI)