CAS 120912-37-0 is the registry number for 5-Isocyanatoindane, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg, 2.5g.
5-isocyanato-2,3-dihydro-1H-indene (CAS 120912-37-0) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 5-isocyanato-2,3-dihydro-1H-indene. InChIKey: PYJJKIOYUUDDDM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 5-isocyanato-2,3-dihydro-1H-indene |
| InChIKey | PYJJKIOYUUDDDM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)N=C=O |
Computed by PubChem (NCBI)