CAS 1209457-83-9 appears in our catalog under these names: N-Benzyl-2-chloropyridin-4-amine, 95%, N-Benzyl-2-chloropyridin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N-benzyl-2-chloropyridin-4-amine (CAS 1209457-83-9) is a chemical compound with the molecular formula C12H11ClN2 and a molecular weight of 218.68 g/mol. IUPAC name: N-benzyl-2-chloropyridin-4-amine. InChIKey: DMAFBUMRGGATMO-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2 |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | N-benzyl-2-chloropyridin-4-amine |
| InChIKey | DMAFBUMRGGATMO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC(=NC=C2)Cl |
Computed by PubChem (NCBI)