CAS 120950-85-8 is the registry number for Rel-(1R,5S)-1-vinylspiro[4.5]decan-7-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R,5S)-4-ethenylspiro[4.5]decan-9-one (CAS 120950-85-8) is a chemical compound with the molecular formula C12H18O and a molecular weight of 178.27 g/mol. IUPAC name: (4R,5S)-4-ethenylspiro[4.5]decan-9-one. InChIKey: RZMPXJTWODCTGN-JQWIXIFHSA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 178.27 g/mol |
| IUPAC name | (4R,5S)-4-ethenylspiro[4.5]decan-9-one |
| InChIKey | RZMPXJTWODCTGN-JQWIXIFHSA-N |
| SMILES | C=C[C@H]1CCC[C@@]12CCCC(=O)C2 |
Computed by PubChem (NCBI)