CAS 1209738-40-8 is the registry number for 5,6-Dimethyl-3-(((3-methylthiophen-2-yl)methyl)amino)pyridazine-4-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dimethyl-3-[(3-methylthiophen-2-yl)methylamino]pyridazine-4-carbonitrile (CAS 1209738-40-8) is a chemical compound with the molecular formula C13H14N4S and a molecular weight of 258.34 g/mol. IUPAC name: 5,6-dimethyl-3-[(3-methylthiophen-2-yl)methylamino]pyridazine-4-carbonitrile. InChIKey: RGSNJCNQBMQKQC-UHFFFAOYSA-N.
| Molecular formula | C13H14N4S |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | 5,6-dimethyl-3-[(3-methylthiophen-2-yl)methylamino]pyridazine-4-carbonitrile |
| InChIKey | RGSNJCNQBMQKQC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)CNC2=C(C(=C(N=N2)C)C)C#N |
Computed by PubChem (NCBI)