CAS 497060-51-2 is the registry number for 5,6,8-trimethyl-3-methylthio-1,2,4-triazino(5,6-b)indole. Offered by: Biosynth. Available pack sizes: 250mg.
5,6,8-trimethyl-3-methylsulfanyl-[1,2,4]triazino[5,6-b]indole (CAS 497060-51-2) is a chemical compound with the molecular formula C13H14N4S and a molecular weight of 258.34 g/mol. IUPAC name: 5,6,8-trimethyl-3-methylsulfanyl-[1,2,4]triazino[5,6-b]indole. InChIKey: YQQMHPCFXOBJSK-UHFFFAOYSA-N.
| Molecular formula | C13H14N4S |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | 5,6,8-trimethyl-3-methylsulfanyl-[1,2,4]triazino[5,6-b]indole |
| InChIKey | YQQMHPCFXOBJSK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C3=C(N2C)N=C(N=N3)SC)C |
Computed by PubChem (NCBI)