CAS 6268-26-4 appears in our catalog under these names: 1,3-Bis(4-aminophenyl)thiourea, 98%, 1,3-Bis(4-aminophenyl)thiourea, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-bis(4-aminophenyl)thiourea (CAS 6268-26-4) is a chemical compound with the molecular formula C13H14N4S and a molecular weight of 258.34 g/mol. IUPAC name: 1,3-bis(4-aminophenyl)thiourea. InChIKey: BOXVYMDQQMOOGS-UHFFFAOYSA-N.
| Molecular formula | C13H14N4S |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | 1,3-bis(4-aminophenyl)thiourea |
| InChIKey | BOXVYMDQQMOOGS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NC(=S)NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)