Products 1209773-69-2
CAS 1209773-69-2 is the registry number for 5-(3,4-Dihydro-2H-1,4-benzoxazin-6-yl)thiophene-2-carboxamide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)thiophene-2-carboxamide;hydrochloride (CAS 1209773-69-2) is a chemical compound with the molecular formula C13H13ClN2O2S and a molecular weight of 296.77 g/mol. IUPAC name: 5-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)thiophene-2-carboxamide;hydrochloride. InChIKey: WZYUTBOZCZXKDK-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2S |
|---|---|
| Molecular weight | 296.77 g/mol |
| IUPAC name | 5-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)thiophene-2-carboxamide;hydrochloride |
| InChIKey | WZYUTBOZCZXKDK-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=C(C=C2)C3=CC=C(S3)C(=O)N.Cl |
Computed by PubChem (NCBI)