Products 326023-04-5
CAS 326023-04-5 is the registry number for 3-Amino-n-(3-chloro-phenyl)-4-methyl-benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g.
3-amino-N-(3-chlorophenyl)-4-methylbenzenesulfonamide (CAS 326023-04-5) is a chemical compound with the molecular formula C13H13ClN2O2S and a molecular weight of 296.77 g/mol. IUPAC name: 3-amino-N-(3-chlorophenyl)-4-methylbenzenesulfonamide. InChIKey: KAQZLOJOTKYBDO-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2S |
|---|---|
| Molecular weight | 296.77 g/mol |
| IUPAC name | 3-amino-N-(3-chlorophenyl)-4-methylbenzenesulfonamide |
| InChIKey | KAQZLOJOTKYBDO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NC2=CC(=CC=C2)Cl)N |
Computed by PubChem (NCBI)