Products 554438-93-6
CAS 554438-93-6 appears in our catalog under these names: 6-Chloro-pyridine-3-sulfonic acid ethyl-phenyl-amide, 95%, 6-Chloro-N-ethyl-N-phenylpyridine-3-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
6-chloro-N-ethyl-N-phenylpyridine-3-sulfonamide (CAS 554438-93-6) is a chemical compound with the molecular formula C13H13ClN2O2S and a molecular weight of 296.77 g/mol. IUPAC name: 6-chloro-N-ethyl-N-phenylpyridine-3-sulfonamide. InChIKey: HWBNYAVEICJOTN-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2S |
|---|---|
| Molecular weight | 296.77 g/mol |
| IUPAC name | 6-chloro-N-ethyl-N-phenylpyridine-3-sulfonamide |
| InChIKey | HWBNYAVEICJOTN-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=CC=C1)S(=O)(=O)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)