CAS 1209780-78-8 is the registry number for (3S,4S)-Benzyl 3-fluoro-4-hydroxypiperidine-1-carboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.
Benzyl (3S,4S)-3-fluoro-4-hydroxypiperidine-1-carboxylate (CAS 1209780-78-8) is a chemical compound with the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. IUPAC name: benzyl (3S,4S)-3-fluoro-4-hydroxypiperidine-1-carboxylate. InChIKey: RKRKELORNFODMN-RYUDHWBXSA-N.
| Molecular formula | C13H16FNO3 |
|---|---|
| Molecular weight | 253.27 g/mol |
| IUPAC name | benzyl (3S,4S)-3-fluoro-4-hydroxypiperidine-1-carboxylate |
| InChIKey | RKRKELORNFODMN-RYUDHWBXSA-N |
| SMILES | C1CN(C[C@@H]([C@H]1O)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)