Products 1210002-69-9
CAS 1210002-69-9 is the registry number for 2-(2-Chlorophenoxy)-N-(2,2,2-trifluoroethyl)acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chlorophenoxy)-N-(2,2,2-trifluoroethyl)acetamide (CAS 1210002-69-9) is a chemical compound with the molecular formula C10H9ClF3NO2 and a molecular weight of 267.63 g/mol. IUPAC name: 2-(2-chlorophenoxy)-N-(2,2,2-trifluoroethyl)acetamide. InChIKey: GBXBANLIBDYPTA-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3NO2 |
|---|---|
| Molecular weight | 267.63 g/mol |
| IUPAC name | 2-(2-chlorophenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
| InChIKey | GBXBANLIBDYPTA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC(=O)NCC(F)(F)F)Cl |
Computed by PubChem (NCBI)