Products 851721-86-3
CAS 851721-86-3 appears in our catalog under these names: 2-Chloro-n-[4-(trifluoromethoxy)phenyl]propanamide, 95%, 2-chloro-N-(4-(trifluoromethoxy)phenyl)propanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g.
2-chloro-N-[4-(trifluoromethoxy)phenyl]propanamide (CAS 851721-86-3) is a chemical compound with the molecular formula C10H9ClF3NO2 and a molecular weight of 267.63 g/mol. IUPAC name: 2-chloro-N-[4-(trifluoromethoxy)phenyl]propanamide. InChIKey: YVFWBXRZKCHTLV-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3NO2 |
|---|---|
| Molecular weight | 267.63 g/mol |
| IUPAC name | 2-chloro-N-[4-(trifluoromethoxy)phenyl]propanamide |
| InChIKey | YVFWBXRZKCHTLV-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC=C(C=C1)OC(F)(F)F)Cl |
Computed by PubChem (NCBI)