Products 949293-96-3
CAS 949293-96-3 appears in our catalog under these names: 2-Chloro-n-[2-(trifluoromethoxy)benzyl]acetamide, 95%, 2-Chloro-N-{(2-(trifluoromethoxy)phenyl)methyl}acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide (CAS 949293-96-3) is a chemical compound with the molecular formula C10H9ClF3NO2 and a molecular weight of 267.63 g/mol. IUPAC name: 2-chloro-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide. InChIKey: VIRVJTVEHSCLSW-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3NO2 |
|---|---|
| Molecular weight | 267.63 g/mol |
| IUPAC name | 2-chloro-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide |
| InChIKey | VIRVJTVEHSCLSW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC(=O)CCl)OC(F)(F)F |
Computed by PubChem (NCBI)