CAS 1210048-11-5 appears in our catalog under these names: 5-Bromo-3,4-difluorobenzene-1,2-diamine, 98%, 5-Bromo-3,4-difluorobenzene-1,2-diamine 98%, 5-Bromo-3,4-difluorobenzene-1,2-diamine, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
5-bromo-3,4-difluorobenzene-1,2-diamine (CAS 1210048-11-5) is a chemical compound with the molecular formula C6H5BrF2N2 and a molecular weight of 223.02 g/mol. IUPAC name: 5-bromo-3,4-difluorobenzene-1,2-diamine. InChIKey: BOQXFEVROLOZHE-UHFFFAOYSA-N.
| Molecular formula | C6H5BrF2N2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | 5-bromo-3,4-difluorobenzene-1,2-diamine |
| InChIKey | BOQXFEVROLOZHE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)F)N)N |
Computed by PubChem (NCBI)