CAS 1823344-37-1 appears in our catalog under these names: 4-Bromo-3,5-difluorobenzene-1,2-diamine, 98%, 4-Bromo-3,5-difluorobenzene-1,2-diamine 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 50mg, 100mg, 250mg.
4-bromo-3,5-difluorobenzene-1,2-diamine (CAS 1823344-37-1) is a chemical compound with the molecular formula C6H5BrF2N2 and a molecular weight of 223.02 g/mol. IUPAC name: 4-bromo-3,5-difluorobenzene-1,2-diamine. InChIKey: MCZQSDPCMGQASV-UHFFFAOYSA-N.
| Molecular formula | C6H5BrF2N2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | 4-bromo-3,5-difluorobenzene-1,2-diamine |
| InChIKey | MCZQSDPCMGQASV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)F)N)N |
Computed by PubChem (NCBI)