CAS 153505-35-2 appears in our catalog under these names: 3-Bromo-4,5-difluorobenzene-1,2-diamine, 95%, 3-Bromo-4,5-difluorobenzene-1,2-diamine, ≥97%, ≥97%, 3-BROMO-4,5-DIFLUOROBENZENE-1,2-DIAMINE, ≥97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
3-bromo-4,5-difluorobenzene-1,2-diamine (CAS 153505-35-2) is a chemical compound with the molecular formula C6H5BrF2N2 and a molecular weight of 223.02 g/mol. IUPAC name: 3-bromo-4,5-difluorobenzene-1,2-diamine. InChIKey: LKNCMGLEYLDJKY-UHFFFAOYSA-N.
| Molecular formula | C6H5BrF2N2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | 3-bromo-4,5-difluorobenzene-1,2-diamine |
| InChIKey | LKNCMGLEYLDJKY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Br)N)N |
Computed by PubChem (NCBI)