Products 1210156-96-9
CAS 1210156-96-9 is the registry number for 3-(((6-Chloropyridin-3-yl)methyl)thio)-[1,2,4]triazolo[4,3-a]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(6-chloro-3-pyridinyl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine (CAS 1210156-96-9) is a chemical compound with the molecular formula C12H9ClN4S and a molecular weight of 276.75 g/mol. IUPAC name: 3-[(6-chloro-3-pyridinyl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: NQGBCXSRPPTMFS-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4S |
|---|---|
| Molecular weight | 276.75 g/mol |
| IUPAC name | 3-[(6-chloro-3-pyridinyl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | NQGBCXSRPPTMFS-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN=C(N2C=C1)SCC3=CN=C(C=C3)Cl |
Computed by PubChem (NCBI)