CAS 871266-80-7 is the registry number for 7–Chloro–N–(p–tolyl)thiazolo(5,4–d)pyrimidin–2–amine. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
7-chloro-N-(4-methylphenyl)-[1,3]thiazolo[5,4-d]pyrimidin-2-amine (CAS 871266-80-7) is a chemical compound with the molecular formula C12H9ClN4S and a molecular weight of 276.75 g/mol. IUPAC name: 7-chloro-N-(4-methylphenyl)-[1,3]thiazolo[5,4-d]pyrimidin-2-amine. InChIKey: XJXOZVKBZZJUHT-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4S |
|---|---|
| Molecular weight | 276.75 g/mol |
| IUPAC name | 7-chloro-N-(4-methylphenyl)-[1,3]thiazolo[5,4-d]pyrimidin-2-amine |
| InChIKey | XJXOZVKBZZJUHT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=NC3=C(S2)N=CN=C3Cl |
Computed by PubChem (NCBI)