CAS 330473-50-2 is the registry number for 5-(4-Chlorophenyl)-4-hydrazinothieno[2,3-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine (CAS 330473-50-2) is a chemical compound with the molecular formula C12H9ClN4S and a molecular weight of 276.75 g/mol. IUPAC name: [5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine. InChIKey: HICQHNLZSBLKTG-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN4S |
|---|---|
| Molecular weight | 276.75 g/mol |
| IUPAC name | [5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| InChIKey | HICQHNLZSBLKTG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC3=NC=NC(=C23)NN)Cl |
Computed by PubChem (NCBI)